C72H52N6 — CID 91477706
4-[3-[3-(9-octa-1,3-dien-3-yl-2,7-diphenylpyrido[3,2-h]quinazolin-4-yl)phenyl]phenyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline (PubChem CID 91477706) has the molecular formula C72H52N6 and a molecular weight of 1001.25 g/mol. Its IUPAC name is 4-[3-[3-(9-octa-1,3-dien-3-yl-2,7-diphenylpyrido[3,2-h]quinazolin-4-yl)phenyl]phenyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline.
| Compound Name | 4-[3-[3-(9-octa-1,3-dien-3-yl-2,7-diphenylpyrido[3,2-h]quinazolin-4-yl)phenyl]phenyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline |
|---|---|
| PubChem CID | 91477706 |
| Molecular Formula | C72H52N6 |
| Molecular Weight | 1001.25 g/mol |
| Exact Mass | 1000.43 |
| IUPAC Name | 4-[3-[3-(9-octa-1,3-dien-3-yl-2,7-diphenylpyrido[3,2-h]quinazolin-4-yl)phenyl]phenyl]-2,7,9-triphenylpyrido[3,2-h]quinazoline |
| SMILES | C=CC(=CCCCC)c1cc(-c2ccccc2)c2ccc3c(-c4cccc(-c5cccc(-c6nc(-c7ccccc7)nc7c6ccc6c(-c8ccccc8)cc(-c8ccccc8)nc67)c5)c4)nc(-c4ccccc4)nc3c2n1 |
| InChI | InChI=1S/C72H52N6/c1-3-5-11-24-47(4-2)63-45-61(48-25-12-6-13-26-48)57-39-41-59-65(75-71(51-31-18-9-19-32-51)77-69(59)67(57)73-63)55-37-22-35-53(43-55)54-36-23-38-56(44-54)66-60-42-40-58-62(49-27-14-7-15-28-49)46-64(50-29-16-8-17-30-50)74-68(58)70(60)78-72(76-66)52-33-20-10-21-34-52/h4,6-10,12-46H,2-3,5,11H2,1H3 |
| InChIKey | PWEMZUWRDYXYGX-UHFFFAOYSA-N |
| XLogP | 18.76 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.25 |
| LogP ≤ 5 | 18.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|