C13H12N2O8 — CID 91478534
methyl 3-nitrocyclopenta-1,3-diene-1-carboxylate;3-nitrocyclopenta-1,3-diene-1-carboxylic acid (PubChem CID 91478534) has the molecular formula C13H12N2O8 and a molecular weight of 324.25 g/mol. Its IUPAC name is methyl 3-nitrocyclopenta-1,3-diene-1-carboxylate;3-nitrocyclopenta-1,3-diene-1-carboxylic acid.
| Compound Name | methyl 3-nitrocyclopenta-1,3-diene-1-carboxylate;3-nitrocyclopenta-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 91478534 |
| Molecular Formula | C13H12N2O8 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | methyl 3-nitrocyclopenta-1,3-diene-1-carboxylate;3-nitrocyclopenta-1,3-diene-1-carboxylic acid |
| SMILES | COC(=O)C1=CC([N+](=O)[O-])=CC1.O=C(O)C1=CC([N+](=O)[O-])=CC1 |
| InChI | InChI=1S/C7H7NO4.C6H5NO4/c1-12-7(9)5-2-3-6(4-5)8(10)11;8-6(9)4-1-2-5(3-4)7(10)11/h3-4H,2H2,1H3;2-3H,1H2,(H,8,9) |
| InChIKey | RFRFONZSOZXFOO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 149.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|