C7H7NO4 — CID 20619347
methyl 3-nitrocyclopenta-1,3-diene-1-carboxylate (PubChem CID 20619347) has the molecular formula C7H7NO4 and a molecular weight of 169.14 g/mol. Its IUPAC name is methyl 3-nitrocyclopenta-1,3-diene-1-carboxylate.
| Compound Name | methyl 3-nitrocyclopenta-1,3-diene-1-carboxylate |
|---|---|
| PubChem CID | 20619347 |
| Molecular Formula | C7H7NO4 |
| Molecular Weight | 169.14 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | methyl 3-nitrocyclopenta-1,3-diene-1-carboxylate |
| SMILES | COC(=O)C1=CC([N+](=O)[O-])=CC1 |
| InChI | InChI=1S/C7H7NO4/c1-12-7(9)5-2-3-6(4-5)8(10)11/h3-4H,2H2,1H3 |
| InChIKey | VQUIPVZFJCKKBV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|