C12H15NO4 — CID 143208373
methyl (2E,8E)-4-methylidene-8-nitrodeca-2,6,8-trienoate (PubChem CID 143208373) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is methyl (2E,8E)-4-methylidene-8-nitrodeca-2,6,8-trienoate.
| Compound Name | methyl (2E,8E)-4-methylidene-8-nitrodeca-2,6,8-trienoate |
|---|---|
| PubChem CID | 143208373 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | methyl (2E,8E)-4-methylidene-8-nitrodeca-2,6,8-trienoate |
| SMILES | C=C(/C=C/C(=O)OC)CC=C/C(=C\C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H15NO4/c1-4-11(13(15)16)7-5-6-10(2)8-9-12(14)17-3/h4-5,7-9H,2,6H2,1,3H3/b7-5?,9-8+,11-4+ |
| InChIKey | YIQBTSNXLXRQCD-ABBCNICHSA-N |
| XLogP | 2.40 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|