About ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate
ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate (PubChem CID 143788277) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate.
Analyze ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate?
The IUPAC name of ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate (CID 143788277) is ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate.
What is the SMILES notation for ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate?
The canonical SMILES for ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate is CC.COC(=O)C1=CC=C(N=O)C=CC1.
What is the InChIKey of ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate?
The InChIKey is PZMQUAINAQIACE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3.C2H6/c1-13-9(11)7-3-2-4-8(10-12)6-5-7;1-2/h2,4-6H,3H2,1H3;1-2H3.
What are the key properties of ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate?
ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate has a molecular weight of 209.24 g/mol, XLogP of 2.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate is sourced from PubChem (CID 143788277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).