C9H9NO4 — CID 142831634
methyl 3-nitrocyclohepta-1,3,6-triene-1-carboxylate (PubChem CID 142831634) has the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. Its IUPAC name is methyl 3-nitrocyclohepta-1,3,6-triene-1-carboxylate.
| Compound Name | methyl 3-nitrocyclohepta-1,3,6-triene-1-carboxylate |
|---|---|
| PubChem CID | 142831634 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | methyl 3-nitrocyclohepta-1,3,6-triene-1-carboxylate |
| SMILES | COC(=O)C1=CC([N+](=O)[O-])=CCC=C1 |
| InChI | InChI=1S/C9H9NO4/c1-14-9(11)7-4-2-3-5-8(6-7)10(12)13/h2,4-6H,3H2,1H3 |
| InChIKey | YSDYGORVXHQATC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|