About methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate
methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate (PubChem CID 143788278) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate.
Analyze methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate?
The IUPAC name of methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate (CID 143788278) is methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate.
What is the SMILES notation for methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate?
The canonical SMILES for methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate is COC(=O)C1=CC=C(N=O)C=CC1.
What is the InChIKey of methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate?
The InChIKey is JGQTXCUDXSIBJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c1-13-9(11)7-3-2-4-8(10-12)6-5-7/h2,4-6H,3H2,1H3.
What are the key properties of methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate?
methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate has a molecular weight of 179.17 g/mol, XLogP of 1.70, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-nitrosocyclohepta-1,3,5-triene-1-carboxylate is sourced from PubChem (CID 143788278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).