C13H14N2 — CID 91478953
6,11,11a,11b-tetrahydrobenzo[a]quinolizin-7-imine (PubChem CID 91478953) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 6,11,11a,11b-tetrahydrobenzo[a]quinolizin-7-imine.
| Compound Name | 6,11,11a,11b-tetrahydrobenzo[a]quinolizin-7-imine |
|---|---|
| PubChem CID | 91478953 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 6,11,11a,11b-tetrahydrobenzo[a]quinolizin-7-imine |
| SMILES | [H]/N=C1\CN2C=CC=CC2C2CC=CC=C12 |
| InChI | InChI=1S/C13H14N2/c14-12-9-15-8-4-3-7-13(15)11-6-2-1-5-10(11)12/h1-5,7-8,11,13-14H,6,9H2/b14-12+ |
| InChIKey | FLEZNOQOPPYNLV-WYMLVPIESA-N |
| XLogP | 2.28 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|