C20H14F3N3O2S — CID 91481173
8-[hydroxy-(1,3-thiazol-2-ylamino)methyl]-2-[2-(trifluoromethyl)phenyl]-1H-quinolin-4-one (PubChem CID 91481173) has the molecular formula C20H14F3N3O2S and a molecular weight of 417.41 g/mol. Its IUPAC name is 8-[hydroxy-(1,3-thiazol-2-ylamino)methyl]-2-[2-(trifluoromethyl)phenyl]-1H-quinolin-4-one.
| Compound Name | 8-[hydroxy-(1,3-thiazol-2-ylamino)methyl]-2-[2-(trifluoromethyl)phenyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 91481173 |
| Molecular Formula | C20H14F3N3O2S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 8-[hydroxy-(1,3-thiazol-2-ylamino)methyl]-2-[2-(trifluoromethyl)phenyl]-1H-quinolin-4-one |
| SMILES | O=c1cc(-c2ccccc2C(F)(F)F)[nH]c2c(C(O)Nc3nccs3)cccc12 |
| InChI | InChI=1S/C20H14F3N3O2S/c21-20(22,23)14-7-2-1-4-11(14)15-10-16(27)12-5-3-6-13(17(12)25-15)18(28)26-19-24-8-9-29-19/h1-10,18,28H,(H,24,26)(H,25,27) |
| InChIKey | NZYYJUCOVFVUHJ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|