C21H22N4O2S — CID 91484912
N-(3-penta-1,3-dien-2-yl-1,2-oxazol-5-yl)-3-phenyl-2-(1,3-thiazol-4-ylmethylamino)propanamide (PubChem CID 91484912) has the molecular formula C21H22N4O2S and a molecular weight of 394.50 g/mol. Its IUPAC name is N-(3-penta-1,3-dien-2-yl-1,2-oxazol-5-yl)-3-phenyl-2-(1,3-thiazol-4-ylmethylamino)propanamide.
| Compound Name | N-(3-penta-1,3-dien-2-yl-1,2-oxazol-5-yl)-3-phenyl-2-(1,3-thiazol-4-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 91484912 |
| Molecular Formula | C21H22N4O2S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(3-penta-1,3-dien-2-yl-1,2-oxazol-5-yl)-3-phenyl-2-(1,3-thiazol-4-ylmethylamino)propanamide |
| SMILES | C=C(C=CC)c1cc(NC(=O)C(Cc2ccccc2)NCc2cscn2)on1 |
| InChI | InChI=1S/C21H22N4O2S/c1-3-7-15(2)18-11-20(27-25-18)24-21(26)19(10-16-8-5-4-6-9-16)22-12-17-13-28-14-23-17/h3-9,11,13-14,19,22H,2,10,12H2,1H3,(H,24,26) |
| InChIKey | WOIHZHGNMHQAFI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|