C13H16N2OS — CID 63261586
3-phenyl-2-(1,3-thiazol-4-ylmethylamino)propan-1-ol (PubChem CID 63261586) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-phenyl-2-(1,3-thiazol-4-ylmethylamino)propan-1-ol.
| Compound Name | 3-phenyl-2-(1,3-thiazol-4-ylmethylamino)propan-1-ol |
|---|---|
| PubChem CID | 63261586 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-phenyl-2-(1,3-thiazol-4-ylmethylamino)propan-1-ol |
| SMILES | OCC(Cc1ccccc1)NCc1cscn1 |
| InChI | InChI=1S/C13H16N2OS/c16-8-12(6-11-4-2-1-3-5-11)14-7-13-9-17-10-15-13/h1-5,9-10,12,14,16H,6-8H2 |
| InChIKey | VBUAPKURQWJMEE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |