C17H19N3O — CID 63261332
2-(imidazo[1,2-a]pyridin-2-ylmethylamino)-3-phenylpropan-1-ol (PubChem CID 63261332) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(imidazo[1,2-a]pyridin-2-ylmethylamino)-3-phenylpropan-1-ol.
| Compound Name | 2-(imidazo[1,2-a]pyridin-2-ylmethylamino)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 63261332 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-(imidazo[1,2-a]pyridin-2-ylmethylamino)-3-phenylpropan-1-ol |
| SMILES | OCC(Cc1ccccc1)NCc1cn2ccccc2n1 |
| InChI | InChI=1S/C17H19N3O/c21-13-15(10-14-6-2-1-3-7-14)18-11-16-12-20-9-5-4-8-17(20)19-16/h1-9,12,15,18,21H,10-11,13H2 |
| InChIKey | YCFBCIIALLJNRO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |