C19H26N6O3 — CID 91485425
N-[3-(dimethylamino)propyl]-4-(methoxymethyl)-3-(pyrazin-2-ylcarbamoylamino)benzamide (PubChem CID 91485425) has the molecular formula C19H26N6O3 and a molecular weight of 386.46 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-4-(methoxymethyl)-3-(pyrazin-2-ylcarbamoylamino)benzamide.
| Compound Name | N-[3-(dimethylamino)propyl]-4-(methoxymethyl)-3-(pyrazin-2-ylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 91485425 |
| Molecular Formula | C19H26N6O3 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-4-(methoxymethyl)-3-(pyrazin-2-ylcarbamoylamino)benzamide |
| SMILES | COCc1ccc(C(=O)NCCCN(C)C)cc1NC(=O)Nc1cnccn1 |
| InChI | InChI=1S/C19H26N6O3/c1-25(2)10-4-7-22-18(26)14-5-6-15(13-28-3)16(11-14)23-19(27)24-17-12-20-8-9-21-17/h5-6,8-9,11-12H,4,7,10,13H2,1-3H3,(H,22,26)(H2,21,23,24,27) |
| InChIKey | INUPHZOZVJBLSM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|