C19H15NO — CID 91485748
4-(nitrosomethyl)-1,2-diphenylbenzene (PubChem CID 91485748) has the molecular formula C19H15NO and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-(nitrosomethyl)-1,2-diphenylbenzene.
| Compound Name | 4-(nitrosomethyl)-1,2-diphenylbenzene |
|---|---|
| PubChem CID | 91485748 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 4-(nitrosomethyl)-1,2-diphenylbenzene |
| SMILES | O=NCc1ccc(-c2ccccc2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H15NO/c21-20-14-15-11-12-18(16-7-3-1-4-8-16)19(13-15)17-9-5-2-6-10-17/h1-13H,14H2 |
| InChIKey | MLBZDTAIIVFHLO-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |