C31H33F2N5O7 — CID 91487705
ethyl 6-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate (PubChem CID 91487705) has the molecular formula C31H33F2N5O7 and a molecular weight of 625.63 g/mol. Its IUPAC name is ethyl 6-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate.
| Compound Name | ethyl 6-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 91487705 |
| Molecular Formula | C31H33F2N5O7 |
| Molecular Weight | 625.63 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | ethyl 6-[4-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]piperazin-1-yl]-7-fluoro-2-methyl-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylate |
| SMILES | CCOC(=O)c1cn2c3c(c(N4CCN(c5ccc(N6CC(CNC(C)=O)OC6=O)cc5F)CC4)c(F)cc3c1=O)OCC2C |
| InChI | InChI=1S/C31H33F2N5O7/c1-4-43-30(41)22-15-37-17(2)16-44-29-26(37)21(28(22)40)12-24(33)27(29)36-9-7-35(8-10-36)25-6-5-19(11-23(25)32)38-14-20(45-31(38)42)13-34-18(3)39/h5-6,11-12,15,17,20H,4,7-10,13-14,16H2,1-3H3,(H,34,39) |
| InChIKey | XZIVNBNQOREVFM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|