C22H22N8O — CID 91488299
N-[(5-aminopyrazin-2-yl)methyl]-3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)benzamide (PubChem CID 91488299) has the molecular formula C22H22N8O and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[(5-aminopyrazin-2-yl)methyl]-3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)benzamide.
| Compound Name | N-[(5-aminopyrazin-2-yl)methyl]-3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 91488299 |
| Molecular Formula | C22H22N8O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-[(5-aminopyrazin-2-yl)methyl]-3-(5-ethyltetrazol-1-yl)-5-(4-methylphenyl)benzamide |
| SMILES | CCc1nnnn1-c1cc(C(=O)NCc2cnc(N)cn2)cc(-c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C22H22N8O/c1-3-21-27-28-29-30(21)19-9-16(15-6-4-14(2)5-7-15)8-17(10-19)22(31)26-12-18-11-25-20(23)13-24-18/h4-11,13H,3,12H2,1-2H3,(H2,23,25)(H,26,31) |
| InChIKey | AXIZAKODNPLKSG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 124.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |