C23H22N6O — CID 91490062
4-[2-[3-[[5-(aminomethyl)-2-pyridinyl]amino]phenyl]ethyl]quinazoline-8-carboxamide (PubChem CID 91490062) has the molecular formula C23H22N6O and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-[2-[3-[[5-(aminomethyl)-2-pyridinyl]amino]phenyl]ethyl]quinazoline-8-carboxamide.
| Compound Name | 4-[2-[3-[[5-(aminomethyl)-2-pyridinyl]amino]phenyl]ethyl]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 91490062 |
| Molecular Formula | C23H22N6O |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 4-[2-[3-[[5-(aminomethyl)-2-pyridinyl]amino]phenyl]ethyl]quinazoline-8-carboxamide |
| SMILES | NCc1ccc(Nc2cccc(CCc3ncnc4c(C(N)=O)cccc34)c2)nc1 |
| InChI | InChI=1S/C23H22N6O/c24-12-16-8-10-21(26-13-16)29-17-4-1-3-15(11-17)7-9-20-18-5-2-6-19(23(25)30)22(18)28-14-27-20/h1-6,8,10-11,13-14H,7,9,12,24H2,(H2,25,30)(H,26,29) |
| InChIKey | CKGHRPONSIOLHE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |