C33H34FN3O5 — CID 91491063
ethyl 2-[2-(4-fluorophenyl)ethyl]-4-[4-(furan-2-ylmethylcarbamoyl)phenyl]-5-oxo-7-propan-2-yl-4,4a,6,7-tetrahydropyrrolo[3,4-b]pyridine-3-carboxylate (PubChem CID 91491063) has the molecular formula C33H34FN3O5 and a molecular weight of 571.65 g/mol. Its IUPAC name is ethyl 2-[2-(4-fluorophenyl)ethyl]-4-[4-(furan-2-ylmethylcarbamoyl)phenyl]-5-oxo-7-propan-2-yl-4,4a,6,7-tetrahydropyrrolo[3,4-b]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[2-(4-fluorophenyl)ethyl]-4-[4-(furan-2-ylmethylcarbamoyl)phenyl]-5-oxo-7-propan-2-yl-4,4a,6,7-tetrahydropyrrolo[3,4-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 91491063 |
| Molecular Formula | C33H34FN3O5 |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.25 |
| IUPAC Name | ethyl 2-[2-(4-fluorophenyl)ethyl]-4-[4-(furan-2-ylmethylcarbamoyl)phenyl]-5-oxo-7-propan-2-yl-4,4a,6,7-tetrahydropyrrolo[3,4-b]pyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(CCc2ccc(F)cc2)N=C2C(C(C)C)NC(=O)C2C1c1ccc(C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C33H34FN3O5/c1-4-41-33(40)27-25(16-9-20-7-14-23(34)15-8-20)36-30-28(32(39)37-29(30)19(2)3)26(27)21-10-12-22(13-11-21)31(38)35-18-24-6-5-17-42-24/h5-8,10-15,17,19,26,28-29H,4,9,16,18H2,1-3H3,(H,35,38)(H,37,39) |
| InChIKey | WTEYUNPJRONXLO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |