C21H26N2O5S — CID 91491542
tert-butyl 6-methylsulfonyl-4-(quinoline-2-carbonylamino)hex-5-enoate (PubChem CID 91491542) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is tert-butyl 6-methylsulfonyl-4-(quinoline-2-carbonylamino)hex-5-enoate.
| Compound Name | tert-butyl 6-methylsulfonyl-4-(quinoline-2-carbonylamino)hex-5-enoate |
|---|---|
| PubChem CID | 91491542 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | tert-butyl 6-methylsulfonyl-4-(quinoline-2-carbonylamino)hex-5-enoate |
| SMILES | CC(C)(C)OC(=O)CCC(C=CS(C)(=O)=O)NC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C21H26N2O5S/c1-21(2,3)28-19(24)12-10-16(13-14-29(4,26)27)22-20(25)18-11-9-15-7-5-6-8-17(15)23-18/h5-9,11,13-14,16H,10,12H2,1-4H3,(H,22,25) |
| InChIKey | LHZCZMJOOCTWEW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |