C18H23NO2 — CID 91492618
3-[(E)-3-cyclopenta-1,3-dien-1-ylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane (PubChem CID 91492618) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[(E)-3-cyclopenta-1,3-dien-1-ylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane.
| Compound Name | 3-[(E)-3-cyclopenta-1,3-dien-1-ylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane |
|---|---|
| PubChem CID | 91492618 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 3-[(E)-3-cyclopenta-1,3-dien-1-ylprop-2-enoyl]-1,4,6-trimethylpyridin-2-one;ethane |
| SMILES | CC.Cc1cc(C)n(C)c(=O)c1C(=O)/C=C/C1=CC=CC1 |
| InChI | InChI=1S/C16H17NO2.C2H6/c1-11-10-12(2)17(3)16(19)15(11)14(18)9-8-13-6-4-5-7-13;1-2/h4-6,8-10H,7H2,1-3H3;1-2H3/b9-8+; |
| InChIKey | MUTAXEAWXABINR-HRNDJLQDSA-N |
| XLogP | 3.65 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|