C18H23N3O2 — CID 9149292
N-[(Z)-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]furan-2-carboxamide (PubChem CID 9149292) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[(Z)-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(Z)-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 9149292 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | N-[(Z)-(1-cyclohexyl-2,5-dimethylpyrrol-3-yl)methylideneamino]furan-2-carboxamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccco2)c(C)n1C1CCCCC1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-11-15(12-19-20-18(22)17-9-6-10-23-17)14(2)21(13)16-7-4-3-5-8-16/h6,9-12,16H,3-5,7-8H2,1-2H3,(H,20,22)/b19-12- |
| InChIKey | BFMKXKNOAZHUCX-UNOMPAQXSA-N |
| XLogP | 3.97 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|