C24H34O6 — CID 91496020
[(1S,4R,5S,6R)-4,5-diacetyloxy-3-methyl-6-[(2R)-6-methylhepta-4,6-dien-2-yl]cyclohex-2-en-1-yl] 2-methylbut-2-enoate (PubChem CID 91496020) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [(1S,4R,5S,6R)-4,5-diacetyloxy-3-methyl-6-[(2R)-6-methylhepta-4,6-dien-2-yl]cyclohex-2-en-1-yl] 2-methylbut-2-enoate.
| Compound Name | [(1S,4R,5S,6R)-4,5-diacetyloxy-3-methyl-6-[(2R)-6-methylhepta-4,6-dien-2-yl]cyclohex-2-en-1-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 91496020 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [(1S,4R,5S,6R)-4,5-diacetyloxy-3-methyl-6-[(2R)-6-methylhepta-4,6-dien-2-yl]cyclohex-2-en-1-yl] 2-methylbut-2-enoate |
| SMILES | C=C(C)C=CC[C@@H](C)[C@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)C(C)=C[C@@H]1OC(=O)C(C)=CC |
| InChI | InChI=1S/C24H34O6/c1-9-15(4)24(27)30-20-13-17(6)22(28-18(7)25)23(29-19(8)26)21(20)16(5)12-10-11-14(2)3/h9-11,13,16,20-23H,2,12H2,1,3-8H3/t16-,20+,21-,22-,23+/m1/s1 |
| InChIKey | XCZBNYPBEODIIG-INHYGKKTSA-N |
| XLogP | 4.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|