C30H35ClN2O6 — CID 91498372
(1R,4R,6S,7Z,15R,17R)-17-(8-chloro-2-ethoxyquinolin-4-yl)oxy-13-methyl-2,14-dioxo-13-azatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid (PubChem CID 91498372) has the molecular formula C30H35ClN2O6 and a molecular weight of 555.07 g/mol. Its IUPAC name is (1R,4R,6S,7Z,15R,17R)-17-(8-chloro-2-ethoxyquinolin-4-yl)oxy-13-methyl-2,14-dioxo-13-azatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid.
| Compound Name | (1R,4R,6S,7Z,15R,17R)-17-(8-chloro-2-ethoxyquinolin-4-yl)oxy-13-methyl-2,14-dioxo-13-azatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 91498372 |
| Molecular Formula | C30H35ClN2O6 |
| Molecular Weight | 555.07 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | (1R,4R,6S,7Z,15R,17R)-17-(8-chloro-2-ethoxyquinolin-4-yl)oxy-13-methyl-2,14-dioxo-13-azatricyclo[13.3.0.04,6]octadec-7-ene-4-carboxylic acid |
| SMILES | CCOc1cc(O[C@@H]2C[C@H]3C(=O)C[C@]4(C(=O)O)C[C@H]4/C=C\CCCCN(C)C(=O)[C@@H]3C2)c2cccc(Cl)c2n1 |
| InChI | InChI=1S/C30H35ClN2O6/c1-3-38-26-15-25(20-10-8-11-23(31)27(20)32-26)39-19-13-21-22(14-19)28(35)33(2)12-7-5-4-6-9-18-16-30(18,29(36)37)17-24(21)34/h6,8-11,15,18-19,21-22H,3-5,7,12-14,16-17H2,1-2H3,(H,36,37)/b9-6-/t18-,19-,21-,22-,30-/m1/s1 |
| InChIKey | FBYZJEGXFGKLJL-CLIYSVQRSA-N |
| XLogP | 5.31 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.07 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|