C12H12FNO3 — CID 91498486
5-(fluoromethoxy)-N,3-dimethyl-1-benzofuran-2-carboxamide (PubChem CID 91498486) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is 5-(fluoromethoxy)-N,3-dimethyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-(fluoromethoxy)-N,3-dimethyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 91498486 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-(fluoromethoxy)-N,3-dimethyl-1-benzofuran-2-carboxamide |
| SMILES | CNC(=O)c1oc2ccc(OCF)cc2c1C |
| InChI | InChI=1S/C12H12FNO3/c1-7-9-5-8(16-6-13)3-4-10(9)17-11(7)12(15)14-2/h3-5H,6H2,1-2H3,(H,14,15) |
| InChIKey | RMCQRQABQSTDOD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |