C16H26N4O4S2 — CID 9149900
1-[[(2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoyl]amino]-3-(3-methylbutyl)thiourea (PubChem CID 9149900) has the molecular formula C16H26N4O4S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1-[[(2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoyl]amino]-3-(3-methylbutyl)thiourea.
| Compound Name | 1-[[(2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoyl]amino]-3-(3-methylbutyl)thiourea |
|---|---|
| PubChem CID | 9149900 |
| Molecular Formula | C16H26N4O4S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-[[(2S)-2-[(4-methoxyphenyl)sulfonylamino]propanoyl]amino]-3-(3-methylbutyl)thiourea |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](C)C(=O)NNC(=S)NCCC(C)C)cc1 |
| InChI | InChI=1S/C16H26N4O4S2/c1-11(2)9-10-17-16(25)19-18-15(21)12(3)20-26(22,23)14-7-5-13(24-4)6-8-14/h5-8,11-12,20H,9-10H2,1-4H3,(H,18,21)(H2,17,19,25)/t12-/m0/s1 |
| InChIKey | XXEULNKCTQTINS-LBPRGKRZSA-N |
| XLogP | 0.90 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|