C17H19FNP — CID 91499848
1-benzyl-4-(4-fluorophenyl)-1,4-azaphosphinane (PubChem CID 91499848) has the molecular formula C17H19FNP and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-benzyl-4-(4-fluorophenyl)-1,4-azaphosphinane.
| Compound Name | 1-benzyl-4-(4-fluorophenyl)-1,4-azaphosphinane |
|---|---|
| PubChem CID | 91499848 |
| Molecular Formula | C17H19FNP |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 1-benzyl-4-(4-fluorophenyl)-1,4-azaphosphinane |
| SMILES | Fc1ccc(P2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C17H19FNP/c18-16-6-8-17(9-7-16)20-12-10-19(11-13-20)14-15-4-2-1-3-5-15/h1-9H,10-14H2 |
| InChIKey | JVRSADHHKFZSBR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|