C17H20NP — CID 91356669
1-benzyl-4-phenyl-1,4-azaphosphinane (PubChem CID 91356669) has the molecular formula C17H20NP and a molecular weight of 269.33 g/mol. Its IUPAC name is 1-benzyl-4-phenyl-1,4-azaphosphinane.
| Compound Name | 1-benzyl-4-phenyl-1,4-azaphosphinane |
|---|---|
| PubChem CID | 91356669 |
| Molecular Formula | C17H20NP |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-benzyl-4-phenyl-1,4-azaphosphinane |
| SMILES | c1ccc(CN2CCP(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C17H20NP/c1-3-7-16(8-4-1)15-18-11-13-19(14-12-18)17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | MSARVDBBTUWZON-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|