C28H50N2O3 — CID 91500859
1-[2-(2-heptyl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol (PubChem CID 91500859) has the molecular formula C28H50N2O3 and a molecular weight of 462.72 g/mol. Its IUPAC name is 1-[2-(2-heptyl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol.
| Compound Name | 1-[2-(2-heptyl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91500859 |
| Molecular Formula | C28H50N2O3 |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.38 |
| IUPAC Name | 1-[2-(2-heptyl-1,3-oxazolidin-3-yl)ethyl]-3-(4,4,6,6-tetramethyl-2-methylideneheptyl)pyrrole-2,5-diol |
| SMILES | C=C(Cc1cc(O)n(CCN2CCOC2CCCCCCC)c1O)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C28H50N2O3/c1-8-9-10-11-12-13-25-29(16-17-33-25)14-15-30-24(31)19-23(26(30)32)18-22(2)20-28(6,7)21-27(3,4)5/h19,25,31-32H,2,8-18,20-21H2,1,3-7H3 |
| InChIKey | HBRCVPAFUCHDJY-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|