C50H42Si — CID 91501056
17-(9,9-dimethylfluoren-2-yl)-7,10,10-trimethyl-14,21-diphenyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,12,14,16,18,20-nonaene (PubChem CID 91501056) has the molecular formula C50H42Si and a molecular weight of 670.97 g/mol. Its IUPAC name is 17-(9,9-dimethylfluoren-2-yl)-7,10,10-trimethyl-14,21-diphenyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,12,14,16,18,20-nonaene.
| Compound Name | 17-(9,9-dimethylfluoren-2-yl)-7,10,10-trimethyl-14,21-diphenyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,12,14,16,18,20-nonaene |
|---|---|
| PubChem CID | 91501056 |
| Molecular Formula | C50H42Si |
| Molecular Weight | 670.97 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | 17-(9,9-dimethylfluoren-2-yl)-7,10,10-trimethyl-14,21-diphenyl-10-silapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,12,14,16,18,20-nonaene |
| SMILES | CC1C=CC2=C(C1)[Si](C)(C)c1cc3c(-c4ccccc4)c4cc(-c5ccc6c(c5)C(C)(C)c5ccccc5-6)ccc4c(-c4ccccc4)c3cc12 |
| InChI | InChI=1S/C50H42Si/c1-31-20-23-38-40-29-42-43(30-47(40)51(4,5)46(38)26-31)49(33-16-10-7-11-17-33)41-27-34(22-25-39(41)48(42)32-14-8-6-9-15-32)35-21-24-37-36-18-12-13-19-44(36)50(2,3)45(37)28-35/h6-25,27-31H,26H2,1-5H3 |
| InChIKey | IBLPDOGXSZXVKY-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.97 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|