C40H34N4 — CID 91501383
3-[4-(2-cyano-2-phenylethenyl)-2,5-bis[4-(dimethylamino)phenyl]phenyl]-2-phenylprop-2-enenitrile (PubChem CID 91501383) has the molecular formula C40H34N4 and a molecular weight of 570.74 g/mol. Its IUPAC name is 3-[4-(2-cyano-2-phenylethenyl)-2,5-bis[4-(dimethylamino)phenyl]phenyl]-2-phenylprop-2-enenitrile.
| Compound Name | 3-[4-(2-cyano-2-phenylethenyl)-2,5-bis[4-(dimethylamino)phenyl]phenyl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 91501383 |
| Molecular Formula | C40H34N4 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.28 |
| IUPAC Name | 3-[4-(2-cyano-2-phenylethenyl)-2,5-bis[4-(dimethylamino)phenyl]phenyl]-2-phenylprop-2-enenitrile |
| SMILES | CN(C)c1ccc(-c2cc(C=C(C#N)c3ccccc3)c(-c3ccc(N(C)C)cc3)cc2C=C(C#N)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H34N4/c1-43(2)37-19-15-31(16-20-37)39-25-34(24-36(28-42)30-13-9-6-10-14-30)40(32-17-21-38(22-18-32)44(3)4)26-33(39)23-35(27-41)29-11-7-5-8-12-29/h5-26H,1-4H3 |
| InChIKey | NQDQAFHLKSGFCG-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|