C12H27N2O5P — CID 91506556
N-(1-ethoxy-1-oxopropan-2-yl)-methylphosphonamidic acid;1-methylpiperidin-4-ol (PubChem CID 91506556) has the molecular formula C12H27N2O5P and a molecular weight of 310.33 g/mol. Its IUPAC name is N-(1-ethoxy-1-oxopropan-2-yl)-methylphosphonamidic acid;1-methylpiperidin-4-ol.
| Compound Name | N-(1-ethoxy-1-oxopropan-2-yl)-methylphosphonamidic acid;1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 91506556 |
| Molecular Formula | C12H27N2O5P |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-(1-ethoxy-1-oxopropan-2-yl)-methylphosphonamidic acid;1-methylpiperidin-4-ol |
| SMILES | CCOC(=O)C(C)NP(C)(=O)O.CN1CCC(O)CC1 |
| InChI | InChI=1S/C6H14NO4P.C6H13NO/c1-4-11-6(8)5(2)7-12(3,9)10;1-7-4-2-6(8)3-5-7/h5H,4H2,1-3H3,(H2,7,9,10);6,8H,2-5H2,1H3 |
| InChIKey | POAFFGQWRZEJST-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|