C13H26N2 — CID 91507278
ethane;2-methyl-1,4,5,6,7,8-hexahydroquinazoline (PubChem CID 91507278) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is ethane;2-methyl-1,4,5,6,7,8-hexahydroquinazoline.
| Compound Name | ethane;2-methyl-1,4,5,6,7,8-hexahydroquinazoline |
|---|---|
| PubChem CID | 91507278 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | ethane;2-methyl-1,4,5,6,7,8-hexahydroquinazoline |
| SMILES | CC.CC.CC1=NCC2=C(CCCC2)N1 |
| InChI | InChI=1S/C9H14N2.2C2H6/c1-7-10-6-8-4-2-3-5-9(8)11-7;2*1-2/h2-6H2,1H3,(H,10,11);2*1-2H3 |
| InChIKey | PUVJUXWKTNMMHK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |