C11H18N2 — CID 143681586
5-butyl-2,4-dimethyl-6-methylidene-1H-pyrimidine (PubChem CID 143681586) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 5-butyl-2,4-dimethyl-6-methylidene-1H-pyrimidine.
| Compound Name | 5-butyl-2,4-dimethyl-6-methylidene-1H-pyrimidine |
|---|---|
| PubChem CID | 143681586 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 5-butyl-2,4-dimethyl-6-methylidene-1H-pyrimidine |
| SMILES | C=C1NC(C)=NC(C)=C1CCCC |
| InChI | InChI=1S/C11H18N2/c1-5-6-7-11-8(2)12-10(4)13-9(11)3/h2,5-7H2,1,3-4H3,(H,12,13) |
| InChIKey | XLRGVDRWATYVHW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |