C9H9F — CID 91507482
2-fluoro-5-methylocta-1,3,5-trien-7-yne (PubChem CID 91507482) has the molecular formula C9H9F and a molecular weight of 136.17 g/mol. Its IUPAC name is 2-fluoro-5-methylocta-1,3,5-trien-7-yne.
| Compound Name | 2-fluoro-5-methylocta-1,3,5-trien-7-yne |
|---|---|
| PubChem CID | 91507482 |
| Molecular Formula | C9H9F |
| Molecular Weight | 136.17 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 2-fluoro-5-methylocta-1,3,5-trien-7-yne |
| SMILES | C#CC=C(C)C=CC(=C)F |
| InChI | InChI=1S/C9H9F/c1-4-5-8(2)6-7-9(3)10/h1,5-7H,3H2,2H3 |
| InChIKey | RIUFUXDVUAPTBJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.17 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|