C10H10F2NO5P — CID 91507514
4,4-difluoro-3-phenyl-2-(phosphonoamino)but-2-enoic acid (PubChem CID 91507514) has the molecular formula C10H10F2NO5P and a molecular weight of 293.16 g/mol. Its IUPAC name is 4,4-difluoro-3-phenyl-2-(phosphonoamino)but-2-enoic acid.
| Compound Name | 4,4-difluoro-3-phenyl-2-(phosphonoamino)but-2-enoic acid |
|---|---|
| PubChem CID | 91507514 |
| Molecular Formula | C10H10F2NO5P |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 4,4-difluoro-3-phenyl-2-(phosphonoamino)but-2-enoic acid |
| SMILES | O=C(O)C(NP(=O)(O)O)=C(c1ccccc1)C(F)F |
| InChI | InChI=1S/C10H10F2NO5P/c11-9(12)7(6-4-2-1-3-5-6)8(10(14)15)13-19(16,17)18/h1-5,9H,(H,14,15)(H3,13,16,17,18) |
| InChIKey | UOSFCOZVWZVHLO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|