C22H29NO3 — CID 91508008
4-ethoxy-1-[(2R)-7-phenylmethoxy-3,4-dihydro-2H-chromen-2-yl]butan-2-amine (PubChem CID 91508008) has the molecular formula C22H29NO3 and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-ethoxy-1-[(2R)-7-phenylmethoxy-3,4-dihydro-2H-chromen-2-yl]butan-2-amine.
| Compound Name | 4-ethoxy-1-[(2R)-7-phenylmethoxy-3,4-dihydro-2H-chromen-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 91508008 |
| Molecular Formula | C22H29NO3 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | 4-ethoxy-1-[(2R)-7-phenylmethoxy-3,4-dihydro-2H-chromen-2-yl]butan-2-amine |
| SMILES | CCOCCC(N)C[C@H]1CCc2ccc(OCc3ccccc3)cc2O1 |
| InChI | InChI=1S/C22H29NO3/c1-2-24-13-12-19(23)14-21-11-9-18-8-10-20(15-22(18)26-21)25-16-17-6-4-3-5-7-17/h3-8,10,15,19,21H,2,9,11-14,16,23H2,1H3/t19?,21-/m1/s1 |
| InChIKey | QWFSGNHSLPCSRO-VGAJERRHSA-N |
| XLogP | 4.10 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|