C16H15N3OS — CID 91510472
4-[5-(1,3-benzothiazol-6-yl)-3-pyridinyl]morpholine (PubChem CID 91510472) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[5-(1,3-benzothiazol-6-yl)-3-pyridinyl]morpholine.
| Compound Name | 4-[5-(1,3-benzothiazol-6-yl)-3-pyridinyl]morpholine |
|---|---|
| PubChem CID | 91510472 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-[5-(1,3-benzothiazol-6-yl)-3-pyridinyl]morpholine |
| SMILES | c1nc2ccc(-c3cncc(N4CCOCC4)c3)cc2s1 |
| InChI | InChI=1S/C16H15N3OS/c1-2-15-16(21-11-18-15)8-12(1)13-7-14(10-17-9-13)19-3-5-20-6-4-19/h1-2,7-11H,3-6H2 |
| InChIKey | VOQIRLNYHLENCN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |