About 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one
3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 54764569) has the molecular formula C22H18N6O2S
and a molecular weight of 430.49 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one.
Molecular Properties
| Compound Name | 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one |
| PubChem CID | 54764569 |
| Molecular Formula | C22H18N6O2S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2ncc(-c3ccc(N4CCOCC4)cc3)nc2n1-c1ccc2scnc2c1 |
| InChI | InChI=1S/C22H18N6O2S/c29-22-26-20-21(28(22)16-5-6-19-17(11-16)24-13-31-19)25-18(12-23-20)14-1-3-15(4-2-14)27-7-9-30-10-8-27/h1-6,11-13H,7-10H2,(H,23,26,29) |
| InChIKey | MDSLQWWZRJAELV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The IUPAC name of 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one (CID 54764569) is 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one.
What is the SMILES notation for 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The canonical SMILES for 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one is O=c1[nH]c2ncc(-c3ccc(N4CCOCC4)cc3)nc2n1-c1ccc2scnc2c1.
What is the InChIKey of 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one?
The InChIKey is MDSLQWWZRJAELV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N6O2S/c29-22-26-20-21(28(22)16-5-6-19-17(11-16)24-13-31-19)25-18(12-23-20)14-1-3-15(4-2-14)27-7-9-30-10-8-27/h1-6,11-13H,7-10H2,(H,23,26,29).
What are the key properties of 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one?
3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one has a molecular weight of 430.49 g/mol, XLogP of 3.22, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-5-yl)-5-(4-morpholin-4-ylphenyl)-1H-imidazo[4,5-b]pyrazin-2-one is sourced from PubChem (CID 54764569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).