C21H19N5O3 — CID 137154138
5-(4-hydroxyphenyl)-1-(4-morpholin-4-ylphenyl)-3H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 137154138) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is 5-(4-hydroxyphenyl)-1-(4-morpholin-4-ylphenyl)-3H-imidazo[4,5-b]pyrazin-2-one.
| Compound Name | 5-(4-hydroxyphenyl)-1-(4-morpholin-4-ylphenyl)-3H-imidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 137154138 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 5-(4-hydroxyphenyl)-1-(4-morpholin-4-ylphenyl)-3H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2nc(-c3ccc(O)cc3)cnc2n1-c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H19N5O3/c27-17-7-1-14(2-8-17)18-13-22-20-19(23-18)24-21(28)26(20)16-5-3-15(4-6-16)25-9-11-29-12-10-25/h1-8,13,27H,9-12H2,(H,23,24,28) |
| InChIKey | YENWRSDZZAPPPK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|