C21H20N6O — CID 126469863
1-phenyl-5-(4-piperazin-1-ylphenyl)-3H-imidazo[4,5-b]pyrazin-2-one (PubChem CID 126469863) has the molecular formula C21H20N6O and a molecular weight of 372.43 g/mol. Its IUPAC name is 1-phenyl-5-(4-piperazin-1-ylphenyl)-3H-imidazo[4,5-b]pyrazin-2-one.
| Compound Name | 1-phenyl-5-(4-piperazin-1-ylphenyl)-3H-imidazo[4,5-b]pyrazin-2-one |
|---|---|
| PubChem CID | 126469863 |
| Molecular Formula | C21H20N6O |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 1-phenyl-5-(4-piperazin-1-ylphenyl)-3H-imidazo[4,5-b]pyrazin-2-one |
| SMILES | O=c1[nH]c2nc(-c3ccc(N4CCNCC4)cc3)cnc2n1-c1ccccc1 |
| InChI | InChI=1S/C21H20N6O/c28-21-25-19-20(27(21)17-4-2-1-3-5-17)23-14-18(24-19)15-6-8-16(9-7-15)26-12-10-22-11-13-26/h1-9,14,22H,10-13H2,(H,24,25,28) |
| InChIKey | RUNGGLWRIJIFSS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |