C17H16N4O2 — CID 130622966
2-(5-piperazin-1-yl-2-pyridinyl)isoindole-1,3-dione (PubChem CID 130622966) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-(5-piperazin-1-yl-2-pyridinyl)isoindole-1,3-dione.
| Compound Name | 2-(5-piperazin-1-yl-2-pyridinyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 130622966 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-(5-piperazin-1-yl-2-pyridinyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1ccc(N2CCNCC2)cn1 |
| InChI | InChI=1S/C17H16N4O2/c22-16-13-3-1-2-4-14(13)17(23)21(16)15-6-5-12(11-19-15)20-9-7-18-8-10-20/h1-6,11,18H,7-10H2 |
| InChIKey | ZEAFATULEFYQOI-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|