C15H15F3N4 — CID 117212437
5-piperazin-1-yl-2-[2-(trifluoromethyl)phenyl]pyrimidine (PubChem CID 117212437) has the molecular formula C15H15F3N4 and a molecular weight of 308.31 g/mol. Its IUPAC name is 5-piperazin-1-yl-2-[2-(trifluoromethyl)phenyl]pyrimidine.
| Compound Name | 5-piperazin-1-yl-2-[2-(trifluoromethyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 117212437 |
| Molecular Formula | C15H15F3N4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 5-piperazin-1-yl-2-[2-(trifluoromethyl)phenyl]pyrimidine |
| SMILES | FC(F)(F)c1ccccc1-c1ncc(N2CCNCC2)cn1 |
| InChI | InChI=1S/C15H15F3N4/c16-15(17,18)13-4-2-1-3-12(13)14-20-9-11(10-21-14)22-7-5-19-6-8-22/h1-4,9-10,19H,5-8H2 |
| InChIKey | QDGZLQLVKCXVLV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |