C20H29N3O3S — CID 91510768
2-cyano-N-[4-[ethyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]cyclopropane-1-carboxamide (PubChem CID 91510768) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-cyano-N-[4-[ethyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]cyclopropane-1-carboxamide.
| Compound Name | 2-cyano-N-[4-[ethyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91510768 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-cyano-N-[4-[ethyl-(2,4,6-trimethylphenyl)sulfonylamino]butyl]cyclopropane-1-carboxamide |
| SMILES | CCN(CCCCNC(=O)C1CC1C#N)S(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C20H29N3O3S/c1-5-23(9-7-6-8-22-20(24)18-12-17(18)13-21)27(25,26)19-15(3)10-14(2)11-16(19)4/h10-11,17-18H,5-9,12H2,1-4H3,(H,22,24) |
| InChIKey | AGPPERLSYCOBEV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|