C13H12N4O2 — CID 91512308
7-nitro-3,3a,4,5,10,10b-hexahydropyrazolo[3,4-a]carbazole (PubChem CID 91512308) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 7-nitro-3,3a,4,5,10,10b-hexahydropyrazolo[3,4-a]carbazole.
| Compound Name | 7-nitro-3,3a,4,5,10,10b-hexahydropyrazolo[3,4-a]carbazole |
|---|---|
| PubChem CID | 91512308 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 7-nitro-3,3a,4,5,10,10b-hexahydropyrazolo[3,4-a]carbazole |
| SMILES | O=[N+]([O-])c1ccc2[nH]c3c(c2c1)CCC1CN=NC31 |
| InChI | InChI=1S/C13H12N4O2/c18-17(19)8-2-4-11-10(5-8)9-3-1-7-6-14-16-12(7)13(9)15-11/h2,4-5,7,12,15H,1,3,6H2 |
| InChIKey | QRDOXLXGGSADNZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 83.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|