C13H19N3O — CID 91513500
4-cyclopentyloxy-3-imidazol-1-yl-1,2,3,6-tetrahydropyridine (PubChem CID 91513500) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-cyclopentyloxy-3-imidazol-1-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-cyclopentyloxy-3-imidazol-1-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 91513500 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 4-cyclopentyloxy-3-imidazol-1-yl-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(OC2CCCC2)C(n2ccnc2)CNC1 |
| InChI | InChI=1S/C13H19N3O/c1-2-4-11(3-1)17-13-5-6-14-9-12(13)16-8-7-15-10-16/h5,7-8,10-12,14H,1-4,6,9H2 |
| InChIKey | ICSODYBSLTZCTJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |