C27H27NO5 — CID 91513541
2-ethoxycarbonyl-4-[formyl(trityl)amino]butanoic acid (PubChem CID 91513541) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4-[formyl(trityl)amino]butanoic acid.
| Compound Name | 2-ethoxycarbonyl-4-[formyl(trityl)amino]butanoic acid |
|---|---|
| PubChem CID | 91513541 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 2-ethoxycarbonyl-4-[formyl(trityl)amino]butanoic acid |
| SMILES | CCOC(=O)C(CCN(C=O)C(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H27NO5/c1-2-33-26(32)24(25(30)31)18-19-28(20-29)27(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23/h3-17,20,24H,2,18-19H2,1H3,(H,30,31) |
| InChIKey | QYUZXSSRXRNUOA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|