C29H33ClN6O3 — CID 91514049
N-[(8R,8aR)-2-[4-[methyl-(2-pyrrolidin-1-ylacetyl)amino]phenyl]-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-8-yl]-3-chloro-1H-indole-6-carboxamide (PubChem CID 91514049) has the molecular formula C29H33ClN6O3 and a molecular weight of 549.08 g/mol. Its IUPAC name is N-[(8R,8aR)-2-[4-[methyl-(2-pyrrolidin-1-ylacetyl)amino]phenyl]-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-8-yl]-3-chloro-1H-indole-6-carboxamide.
| Compound Name | N-[(8R,8aR)-2-[4-[methyl-(2-pyrrolidin-1-ylacetyl)amino]phenyl]-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-8-yl]-3-chloro-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 91514049 |
| Molecular Formula | C29H33ClN6O3 |
| Molecular Weight | 549.08 g/mol |
| Exact Mass | 548.23 |
| IUPAC Name | N-[(8R,8aR)-2-[4-[methyl-(2-pyrrolidin-1-ylacetyl)amino]phenyl]-3-oxo-1,5,6,7,8,8a-hexahydroimidazo[1,5-a]pyridin-8-yl]-3-chloro-1H-indole-6-carboxamide |
| SMILES | CN(C(=O)CN1CCCC1)c1ccc(N2C[C@@H]3[C@H](NC(=O)c4ccc5c(Cl)c[nH]c5c4)CCCN3C2=O)cc1 |
| InChI | InChI=1S/C29H33ClN6O3/c1-33(27(37)18-34-12-2-3-13-34)20-7-9-21(10-8-20)36-17-26-24(5-4-14-35(26)29(36)39)32-28(38)19-6-11-22-23(30)16-31-25(22)15-19/h6-11,15-16,24,26,31H,2-5,12-14,17-18H2,1H3,(H,32,38)/t24-,26-/m1/s1 |
| InChIKey | CVGLJPKZUUGNDX-AOYPEHQESA-N |
| XLogP | 4.08 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.08 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |