C25H24ClN5O4 — CID 91569967
N-[(7R,7aS)-1-oxo-2-[4-(3-oxomorpholin-4-yl)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-7-yl]-3-chloro-1H-indole-6-carboxamide (PubChem CID 91569967) has the molecular formula C25H24ClN5O4 and a molecular weight of 493.95 g/mol. Its IUPAC name is N-[(7R,7aS)-1-oxo-2-[4-(3-oxomorpholin-4-yl)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-7-yl]-3-chloro-1H-indole-6-carboxamide.
| Compound Name | N-[(7R,7aS)-1-oxo-2-[4-(3-oxomorpholin-4-yl)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-7-yl]-3-chloro-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 91569967 |
| Molecular Formula | C25H24ClN5O4 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[(7R,7aS)-1-oxo-2-[4-(3-oxomorpholin-4-yl)phenyl]-5,6,7,7a-tetrahydro-3H-pyrrolo[1,2-c]imidazol-7-yl]-3-chloro-1H-indole-6-carboxamide |
| SMILES | O=C(N[C@@H]1CCN2CN(c3ccc(N4CCOCC4=O)cc3)C(=O)[C@H]12)c1ccc2c(Cl)c[nH]c2c1 |
| InChI | InChI=1S/C25H24ClN5O4/c26-19-12-27-21-11-15(1-6-18(19)21)24(33)28-20-7-8-29-14-31(25(34)23(20)29)17-4-2-16(3-5-17)30-9-10-35-13-22(30)32/h1-6,11-12,20,23,27H,7-10,13-14H2,(H,28,33)/t20-,23+/m1/s1 |
| InChIKey | KAUMCGLKMXYPDJ-OFNKIYASSA-N |
| XLogP | 2.36 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |