C9H8FNO — CID 91514396
1-fluoro-2,4-dihydroquinolin-3-one (PubChem CID 91514396) has the molecular formula C9H8FNO and a molecular weight of 165.17 g/mol. Its IUPAC name is 1-fluoro-2,4-dihydroquinolin-3-one.
| Compound Name | 1-fluoro-2,4-dihydroquinolin-3-one |
|---|---|
| PubChem CID | 91514396 |
| Molecular Formula | C9H8FNO |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 1-fluoro-2,4-dihydroquinolin-3-one |
| SMILES | O=C1Cc2ccccc2N(F)C1 |
| InChI | InChI=1S/C9H8FNO/c10-11-6-8(12)5-7-3-1-2-4-9(7)11/h1-4H,5-6H2 |
| InChIKey | MVMOYDIRAKTUKI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|