C23H24N2O5S — CID 91514645
5-[(4R,7S)-1,3-dihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-N-ethyl-2-methyl-N-phenylbenzenesulfonamide (PubChem CID 91514645) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is 5-[(4R,7S)-1,3-dihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-N-ethyl-2-methyl-N-phenylbenzenesulfonamide.
| Compound Name | 5-[(4R,7S)-1,3-dihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-N-ethyl-2-methyl-N-phenylbenzenesulfonamide |
|---|---|
| PubChem CID | 91514645 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 5-[(4R,7S)-1,3-dihydroxy-4,5,6,7-tetrahydro-4,7-epoxyisoindol-2-yl]-N-ethyl-2-methyl-N-phenylbenzenesulfonamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1cc(-n2c(O)c3c(c2O)[C@H]2CC[C@@H]3O2)ccc1C |
| InChI | InChI=1S/C23H24N2O5S/c1-3-24(15-7-5-4-6-8-15)31(28,29)19-13-16(10-9-14(19)2)25-22(26)20-17-11-12-18(30-17)21(20)23(25)27/h4-10,13,17-18,26-27H,3,11-12H2,1-2H3/t17-,18+ |
| InChIKey | NQVRAFSHZMHYMI-HDICACEKSA-N |
| XLogP | 4.32 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |